CAS 2795-63-3 appears in our catalog under these names: 2-(4-Fluorophenoxy)benzoic acid, 95%, 2–(4–Fluorophenoxy)benzoic acid, 2-(4-FLUOROPHENOXY)BENZOIC ACID. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-(4-fluorophenoxy)benzoic acid (CAS 2795-63-3) is a chemical compound with the molecular formula C13H9FO3 and a molecular weight of 232.21 g/mol. IUPAC name: 2-(4-fluorophenoxy)benzoic acid. InChIKey: WRWUSRADWXKZGV-UHFFFAOYSA-N.
| Molecular formula | C13H9FO3 |
|---|---|
| Molecular weight | 232.21 g/mol |
| IUPAC name | 2-(4-fluorophenoxy)benzoic acid |
| InChIKey | WRWUSRADWXKZGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)