CAS 1261991-91-6 appears in our catalog under these names: 3-Bromo-5-(4-carboxyphenyl)phenol, 96%, 3-Bromo-5-(4-carboxyphenyl)phenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 25g.
4-(3-bromo-5-hydroxyphenyl)benzoic acid (CAS 1261991-91-6) is a chemical compound with the molecular formula C13H9BrO3 and a molecular weight of 293.11 g/mol. IUPAC name: 4-(3-bromo-5-hydroxyphenyl)benzoic acid. InChIKey: GFLRKQGGLVBGNL-UHFFFAOYSA-N.
| Molecular formula | C13H9BrO3 |
|---|---|
| Molecular weight | 293.11 g/mol |
| IUPAC name | 4-(3-bromo-5-hydroxyphenyl)benzoic acid |
| InChIKey | GFLRKQGGLVBGNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)Br)O)C(=O)O |
Computed by PubChem (NCBI)