Products 77317-51-2

CAS 77317-51-2 is the registry number for 3-(4-Bromophenoxy)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4-bromophenoxy)benzoic acid (CAS 77317-51-2) is a chemical compound with the molecular formula C13H9BrO3 and a molecular weight of 293.11 g/mol. IUPAC name: 3-(4-bromophenoxy)benzoic acid. InChIKey: QCTPFZDEWYZVPR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9BrO3
Molecular weight293.11 g/mol
IUPAC name3-(4-bromophenoxy)benzoic acid
InChIKeyQCTPFZDEWYZVPR-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)OC2=CC=C(C=C2)Br)C(=O)O

Computed by PubChem (NCBI)