Products 74744-77-7

CAS 74744-77-7 is the registry number for 2-(4-Bromophenoxy)benzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-bromophenoxy)benzoic acid (CAS 74744-77-7) is a chemical compound with the molecular formula C13H9BrO3 and a molecular weight of 293.11 g/mol. IUPAC name: 2-(4-bromophenoxy)benzoic acid. InChIKey: AVDBULDTEXDPOR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9BrO3
Molecular weight293.11 g/mol
IUPAC name2-(4-bromophenoxy)benzoic acid
InChIKeyAVDBULDTEXDPOR-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)OC2=CC=C(C=C2)Br

Computed by PubChem (NCBI)