CAS 21120-68-3 appears in our catalog under these names: 4-(4-Bromophenoxy)benzoic acid, 97%, 4-(4-Bromophenoxy)benzoic acid 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 500mg, 2.5g.
4-(4-bromophenoxy)benzoic acid (CAS 21120-68-3) is a chemical compound with the molecular formula C13H9BrO3 and a molecular weight of 293.11 g/mol. IUPAC name: 4-(4-bromophenoxy)benzoic acid. InChIKey: GQZGWHFUVISZQO-UHFFFAOYSA-N.
| Molecular formula | C13H9BrO3 |
|---|---|
| Molecular weight | 293.11 g/mol |
| IUPAC name | 4-(4-bromophenoxy)benzoic acid |
| InChIKey | GQZGWHFUVISZQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)