CAS 1262001-75-1 appears in our catalog under these names: 4-(3-Fluoro-4-methylphenyl)phenol, 98%, 3'-Fluoro-4'-methyl-(1,1'-biphenyl)-4-ol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
4-(3-fluoro-4-methylphenyl)phenol (CAS 1262001-75-1) is a chemical compound with the molecular formula C13H11FO and a molecular weight of 202.22 g/mol. IUPAC name: 4-(3-fluoro-4-methylphenyl)phenol. InChIKey: XVZNGVKCUOUMSI-UHFFFAOYSA-N.
| Molecular formula | C13H11FO |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 4-(3-fluoro-4-methylphenyl)phenol |
| InChIKey | XVZNGVKCUOUMSI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=C(C=C2)O)F |
Computed by PubChem (NCBI)