Products 1262013-21-7
CAS 1262013-21-7 is the registry number for 4-Cyano-3-fluorocinnamic acid, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(4-cyano-3-fluorophenyl)prop-2-enoic acid (CAS 1262013-21-7) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: (E)-3-(4-cyano-3-fluorophenyl)prop-2-enoic acid. InChIKey: ZVPLASMVRCZTIS-DUXPYHPUSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | (E)-3-(4-cyano-3-fluorophenyl)prop-2-enoic acid |
| InChIKey | ZVPLASMVRCZTIS-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)F)C#N |
Computed by PubChem (NCBI)
Synonyms:
4-Cyano-3-fluorocinnamic acid, starbld0018109