CAS 126231-21-8 appears in our catalog under these names: 5-tert-Butyl-1-benzothiophene-2-carboxylic acid, 95%, 5-(tert-Butyl)benzo[b]thiophene-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g.
5-tert-butyl-1-benzothiophene-2-carboxylic acid (CAS 126231-21-8) is a chemical compound with the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. IUPAC name: 5-tert-butyl-1-benzothiophene-2-carboxylic acid. InChIKey: AFIRGXFORSDNIY-UHFFFAOYSA-N.
| Molecular formula | C13H14O2S |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 5-tert-butyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | AFIRGXFORSDNIY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)