Products 2253640-70-7
CAS 2253640-70-7 is the registry number for 1-{5-(3-(Hydroxymethyl)phenyl)thiophen-2-yl}ethan-1-ol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-[5-[3-(hydroxymethyl)phenyl]thiophen-2-yl]ethanol (CAS 2253640-70-7) is a chemical compound with the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. IUPAC name: 1-[5-[3-(hydroxymethyl)phenyl]thiophen-2-yl]ethanol. InChIKey: SXPQSYSNDLJGSE-UHFFFAOYSA-N.
| Molecular formula | C13H14O2S |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 1-[5-[3-(hydroxymethyl)phenyl]thiophen-2-yl]ethanol |
| InChIKey | SXPQSYSNDLJGSE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(S1)C2=CC=CC(=C2)CO)O |
Computed by PubChem (NCBI)