CAS 648905-99-1 is the registry number for Benzo[b]thiophen-6-yl pivalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-benzothiophen-6-yl 2,2-dimethylpropanoate (CAS 648905-99-1) is a chemical compound with the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. IUPAC name: 1-benzothiophen-6-yl 2,2-dimethylpropanoate. InChIKey: JFIIRIAJIUDCPA-UHFFFAOYSA-N.
| Molecular formula | C13H14O2S |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 1-benzothiophen-6-yl 2,2-dimethylpropanoate |
| InChIKey | JFIIRIAJIUDCPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC2=C(C=C1)C=CS2 |
Computed by PubChem (NCBI)