Products 1702660-11-4

CAS 1702660-11-4 is the registry number for 5-(tert-Butyl)benzo[b]thiophene-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-tert-butyl-1-benzothiophene-3-carboxylic acid (CAS 1702660-11-4) is a chemical compound with the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. IUPAC name: 5-tert-butyl-1-benzothiophene-3-carboxylic acid. InChIKey: IXWSUFWQEAZUHD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14O2S
Molecular weight234.32 g/mol
IUPAC name5-tert-butyl-1-benzothiophene-3-carboxylic acid
InChIKeyIXWSUFWQEAZUHD-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC2=C(C=C1)SC=C2C(=O)O

Computed by PubChem (NCBI)