Products 126231-77-4

CAS 126231-77-4 is the registry number for Ethyl 1-piperazinylacetate dihydrochloride. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Ethyl 2-piperazin-1-ylacetate;dihydrochloride (CAS 126231-77-4) is a chemical compound with the molecular formula C8H18Cl2N2O2 and a molecular weight of 245.14 g/mol. IUPAC name: ethyl 2-piperazin-1-ylacetate;dihydrochloride. InChIKey: SDCGGVSLPLXYON-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18Cl2N2O2
Molecular weight245.14 g/mol
IUPAC nameethyl 2-piperazin-1-ylacetate;dihydrochloride
InChIKeySDCGGVSLPLXYON-UHFFFAOYSA-N
SMILESCCOC(=O)CN1CCNCC1.Cl.Cl

Computed by PubChem (NCBI)