CAS 1262415-75-7 is the registry number for 2-Methyl-4-(2,2,2-trifluoroethyl)phenol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methyl-4-(2,2,2-trifluoroethyl)phenol (CAS 1262415-75-7) is a chemical compound with the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. IUPAC name: 2-methyl-4-(2,2,2-trifluoroethyl)phenol. InChIKey: TXZNYYCAIHQOPS-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 2-methyl-4-(2,2,2-trifluoroethyl)phenol |
| InChIKey | TXZNYYCAIHQOPS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CC(F)(F)F)O |
Computed by PubChem (NCBI)