Products 1262769-43-6
CAS 1262769-43-6 appears in our catalog under these names: 5,5-Dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione, 5,5-Dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione, 97%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 2g, 10g, 5g, 250mg.
5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione (CAS 1262769-43-6) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. IUPAC name: 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione. InChIKey: HNPWTDUZIXAJSA-UHFFFAOYSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 5,5-dimethyl-2-(3-methylbutanoyl)cyclohexane-1,3-dione |
| InChIKey | HNPWTDUZIXAJSA-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1C(=O)CC(CC1=O)(C)C |
Computed by PubChem (NCBI)