CAS 1263078-13-2 appears in our catalog under these names: (R)-4-Boc-5-hydroxymethyl-2,2-dimethyl-morpholine, 95%, (R)-tert-Butyl 5-(hydroxymethyl)-2,2-dimethylmorpholine-4-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl (5R)-5-(hydroxymethyl)-2,2-dimethylmorpholine-4-carboxylate (CAS 1263078-13-2) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: tert-butyl (5R)-5-(hydroxymethyl)-2,2-dimethylmorpholine-4-carboxylate. InChIKey: YOYWIKXSQOIMTP-SECBINFHSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | tert-butyl (5R)-5-(hydroxymethyl)-2,2-dimethylmorpholine-4-carboxylate |
| InChIKey | YOYWIKXSQOIMTP-SECBINFHSA-N |
| SMILES | CC1(CN([C@@H](CO1)CO)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)