CAS 1263078-18-7 is the registry number for (S)-tert-Butyl 5-(hydroxymethyl)-2,2-dimethylmorpholine-4-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (5S)-5-(hydroxymethyl)-2,2-dimethylmorpholine-4-carboxylate (CAS 1263078-18-7) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: tert-butyl (5S)-5-(hydroxymethyl)-2,2-dimethylmorpholine-4-carboxylate. InChIKey: YOYWIKXSQOIMTP-VIFPVBQESA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | tert-butyl (5S)-5-(hydroxymethyl)-2,2-dimethylmorpholine-4-carboxylate |
| InChIKey | YOYWIKXSQOIMTP-VIFPVBQESA-N |
| SMILES | CC1(CN([C@H](CO1)CO)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)