CAS 1263279-50-0 is the registry number for 5-Bromo-3-phenyl-1,2,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-3-phenyl-1,2,4-oxadiazole (CAS 1263279-50-0) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 5-bromo-3-phenyl-1,2,4-oxadiazole. InChIKey: YIZUZAUECBVCII-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 5-bromo-3-phenyl-1,2,4-oxadiazole |
| InChIKey | YIZUZAUECBVCII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)Br |
Computed by PubChem (NCBI)