Products 1263285-60-4
CAS 1263285-60-4 is the registry number for 2-Fluoro-4-(perfluoroethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid (CAS 1263285-60-4) is a chemical compound with the molecular formula C9H4F6O2 and a molecular weight of 258.12 g/mol. IUPAC name: 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid. InChIKey: OFQGPZZCMGSNCB-UHFFFAOYSA-N.
| Molecular formula | C9H4F6O2 |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | 2-fluoro-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
| InChIKey | OFQGPZZCMGSNCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(F)(F)F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)