CAS 42175-55-3 is the registry number for 2,3-Bis(trifluoromethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
2,3-bis(trifluoromethyl)benzoic acid (CAS 42175-55-3) is a chemical compound with the molecular formula C9H4F6O2 and a molecular weight of 258.12 g/mol. IUPAC name: 2,3-bis(trifluoromethyl)benzoic acid. InChIKey: UFJRJAOQYVMWEZ-UHFFFAOYSA-N.
| Molecular formula | C9H4F6O2 |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | 2,3-bis(trifluoromethyl)benzoic acid |
| InChIKey | UFJRJAOQYVMWEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)