CAS 725-89-3 appears in our catalog under these names: 3,5-bis(Trifluoromethyl) Benzoic Acid, 3,5-Bis(trifluoromethyl)benzoic Acid, 3,5–Bis(trifluoromethyl)benzoic Acid, 3,5-Bis(trifluoromethyl)benzoic acid, 98% , 3,5-Di(trifluoromethyl)benzoic acid, 97% . Offered by: Chemat Brand, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific. Available pack sizes: on request, 10g, 25g, 5g, 100g, 500g, 1g, 1000g.
3,5-bis(trifluoromethyl)benzoic acid (CAS 725-89-3) is a chemical compound with the molecular formula C9H4F6O2 and a molecular weight of 258.12 g/mol. IUPAC name: 3,5-bis(trifluoromethyl)benzoic acid. InChIKey: HVFQJWGYVXKLTE-UHFFFAOYSA-N.
| Molecular formula | C9H4F6O2 |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | 3,5-bis(trifluoromethyl)benzoic acid |
| InChIKey | HVFQJWGYVXKLTE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)