CAS 24821-22-5 appears in our catalog under these names: 2,6-Bis(trifluoromethyl)benzoic acid, 98%, 2,6-Bis(trifluoromethyl)benzoic acid, 98% , 2,6-Bistrifluoromethyl benzoic acid, 2,6-Bis(trifluoromethyl)benzoic acid 98%, 2,6-BIS(TRIFLUOROMETHYL)BENZOIC ACID, 9&. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros), Ambeed. Available pack sizes: 10g, 5g, 1g, 25g, 2g, 100mg, 250mg, 20g.
2,6-bis(trifluoromethyl)benzoic acid (CAS 24821-22-5) is a chemical compound with the molecular formula C9H4F6O2 and a molecular weight of 258.12 g/mol. IUPAC name: 2,6-bis(trifluoromethyl)benzoic acid. InChIKey: XZNLSDPNMNWCRE-UHFFFAOYSA-N.
| Molecular formula | C9H4F6O2 |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | 2,6-bis(trifluoromethyl)benzoic acid |
| InChIKey | XZNLSDPNMNWCRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)