CAS 126400-75-7 is the registry number for (2S)-2-Amino-4-nitro-butanoic acid. Offered by: TRC. Available pack sizes: 250mg.
(2S)-2-amino-4-nitrobutanoic acid (CAS 126400-75-7) is a chemical compound with the molecular formula C4H8N2O4 and a molecular weight of 148.12 g/mol. IUPAC name: (2S)-2-amino-4-nitrobutanoic acid. InChIKey: YCCLEMIPIFWUCM-VKHMYHEASA-N.
| Molecular formula | C4H8N2O4 |
|---|---|
| Molecular weight | 148.12 g/mol |
| IUPAC name | (2S)-2-amino-4-nitrobutanoic acid |
| InChIKey | YCCLEMIPIFWUCM-VKHMYHEASA-N |
| SMILES | C(C[N+](=O)[O-])[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)