CAS 20790-72-1 is the registry number for (2S,3S)-3-Hydroxyasparagine. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 500mg.
(3S)-3-hydroxy-L-asparagine is a non-proteinogenic L-alpha-amino acid that is the (3S)-hydroxy-derivative of L-asparagine. It is a L-asparagine derivative and a non-proteinogenic L-alpha-amino acid. It is a tautomer of a (3S)-3-hydroxy-L-asparagine zwitterion.
Source: ChEBI
| Molecular formula | C4H8N2O4 |
|---|---|
| Molecular weight | 148.12 g/mol |
| IUPAC name | (2S,3S)-2,4-diamino-3-hydroxy-4-oxobutanoic acid |
| InChIKey | VQTLPSCRBFYDNX-LWMBPPNESA-N |
| SMILES | [C@H]([C@@H](C(=O)N)O)(C(=O)O)N |
Computed by PubChem (NCBI)