CAS 20790-74-3 is the registry number for (2S,3R)-3-Hydroxyasparagine. Offered by: TRC, Biosynth. Available pack sizes: 500mg.
(2S,3R)-2,4-diamino-3-hydroxy-4-oxobutanoic acid (CAS 20790-74-3) is a chemical compound with the molecular formula C4H8N2O4 and a molecular weight of 148.12 g/mol. IUPAC name: (2S,3R)-2,4-diamino-3-hydroxy-4-oxobutanoic acid. InChIKey: VQTLPSCRBFYDNX-NHYDCYSISA-N.
| Molecular formula | C4H8N2O4 |
|---|---|
| Molecular weight | 148.12 g/mol |
| IUPAC name | (2S,3R)-2,4-diamino-3-hydroxy-4-oxobutanoic acid |
| InChIKey | VQTLPSCRBFYDNX-NHYDCYSISA-N |
| SMILES | [C@H]([C@H](C(=O)N)O)(C(=O)O)N |
Computed by PubChem (NCBI)