CAS 921-52-8 appears in our catalog under these names: DL-2,3-diaminosuccinic acid, 2,3-Diaminosuccinic acid, 95+%. Offered by: Creative Peptides, Chemat Brand. Available pack sizes: on request.
(3S)-2,3-diaminobutanedioic acid (CAS 921-52-8) is a chemical compound with the molecular formula C4H8N2O4 and a molecular weight of 148.12 g/mol. IUPAC name: (3S)-2,3-diaminobutanedioic acid. InChIKey: PGNYNCTUBKSHHL-PIKHSQJKSA-N.
| Molecular formula | C4H8N2O4 |
|---|---|
| Molecular weight | 148.12 g/mol |
| IUPAC name | (3S)-2,3-diaminobutanedioic acid |
| InChIKey | PGNYNCTUBKSHHL-PIKHSQJKSA-N |
| SMILES | [C@H](C(C(=O)O)N)(C(=O)O)N |
Computed by PubChem (NCBI)