Products 1264176-33-1
CAS 1264176-33-1 is the registry number for Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (CAS 1264176-33-1) is a chemical compound with the molecular formula C13H18BNO4 and a molecular weight of 263.10 g/mol. IUPAC name: methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate. InChIKey: UNOPLLHECXSEOU-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO4 |
|---|---|
| Molecular weight | 263.10 g/mol |
| IUPAC name | methyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| InChIKey | UNOPLLHECXSEOU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)