Products 126434-73-9
CAS 126434-73-9 appears in our catalog under these names: 5,6-Dihydroxy-1-methyl-1h-indole-2-carboxylic acid, 95%, 5，6–Dihydroxy–1–methyl–1H–indole–2–carboxylic acid, 5,6-Dihydroxy-1-methyl-1H-indole-2-carboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, BLDpharm. Available pack sizes: 5g, 250mg, 1g.
5,6-dihydroxy-1-methylindole-2-carboxylic acid (CAS 126434-73-9) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: 5,6-dihydroxy-1-methylindole-2-carboxylic acid. InChIKey: LKKBPYKGIFSFTQ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | 5,6-dihydroxy-1-methylindole-2-carboxylic acid |
| InChIKey | LKKBPYKGIFSFTQ-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=C(C=C2C=C1C(=O)O)O)O |
Computed by PubChem (NCBI)