CAS 1264481-38-0 appears in our catalog under these names: 7-Chloro-1H-indole-2-carbonitrile, 95%, 7–Chloro–1H–indole–2–carbonitrile, 7-Chloro-1H-indole-2-carbonitrile, 95%, 95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
7-chloro-1H-indole-2-carbonitrile (CAS 1264481-38-0) is a chemical compound with the molecular formula C9H5ClN2 and a molecular weight of 176.60 g/mol. IUPAC name: 7-chloro-1H-indole-2-carbonitrile. InChIKey: VYNDPHOTSBJMAZ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2 |
|---|---|
| Molecular weight | 176.60 g/mol |
| IUPAC name | 7-chloro-1H-indole-2-carbonitrile |
| InChIKey | VYNDPHOTSBJMAZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC(=C2)C#N |
Computed by PubChem (NCBI)