CAS 1427362-93-3 is the registry number for 7-Chloro-1H-indole-6-carbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-1H-indole-6-carbonitrile (CAS 1427362-93-3) is a chemical compound with the molecular formula C9H5ClN2 and a molecular weight of 176.60 g/mol. IUPAC name: 7-chloro-1H-indole-6-carbonitrile. InChIKey: QUHDBOZUNLGZMU-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2 |
|---|---|
| Molecular weight | 176.60 g/mol |
| IUPAC name | 7-chloro-1H-indole-6-carbonitrile |
| InChIKey | QUHDBOZUNLGZMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CN2)Cl)C#N |
Computed by PubChem (NCBI)