CAS 194490-14-7 appears in our catalog under these names: 5-Chloro-1H-indole-3-carbonitrile 98%, 5-Chloro-1H-indole-3-carbonitrile, 97%, 97%, 5-Chloro-1H-indole-3-carbonitrile, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 1g, 10g.
5-chloro-1H-indole-3-carbonitrile (CAS 194490-14-7) is a chemical compound with the molecular formula C9H5ClN2 and a molecular weight of 176.60 g/mol. IUPAC name: 5-chloro-1H-indole-3-carbonitrile. InChIKey: KQMMMHWMPSFPSP-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2 |
|---|---|
| Molecular weight | 176.60 g/mol |
| IUPAC name | 5-chloro-1H-indole-3-carbonitrile |
| InChIKey | KQMMMHWMPSFPSP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CN2)C#N |
Computed by PubChem (NCBI)