CAS 74960-46-6 appears in our catalog under these names: 3-Chloro-1h-indole-2-carbonitrile, 95%, 3–Chloro–1H–indole–2–carbonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
3-chloro-1H-indole-2-carbonitrile (CAS 74960-46-6) is a chemical compound with the molecular formula C9H5ClN2 and a molecular weight of 176.60 g/mol. IUPAC name: 3-chloro-1H-indole-2-carbonitrile. InChIKey: ZJPXWLZSUROYHX-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2 |
|---|---|
| Molecular weight | 176.60 g/mol |
| IUPAC name | 3-chloro-1H-indole-2-carbonitrile |
| InChIKey | ZJPXWLZSUROYHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C#N)Cl |
Computed by PubChem (NCBI)