Products 1266148-30-4
CAS 1266148-30-4 appears in our catalog under these names: 1-(3-bromo-4-chlorophenyl)cyclopropan-1-amine, 1–(3–bromo–4–chlorophenyl)cyclopropan–1–amine Hydrochloride. Offered by: Chemat, GLPBio. Available pack sizes: 100mg, 1g.
1-(3-bromo-4-chlorophenyl)cyclopropan-1-amine (CAS 1266148-30-4) is a chemical compound with the molecular formula C9H9BrClN and a molecular weight of 246.53 g/mol. IUPAC name: 1-(3-bromo-4-chlorophenyl)cyclopropan-1-amine. InChIKey: VOLJEMQWCRJYLP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN |
|---|---|
| Molecular weight | 246.53 g/mol |
| IUPAC name | 1-(3-bromo-4-chlorophenyl)cyclopropan-1-amine |
| InChIKey | VOLJEMQWCRJYLP-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=C(C=C2)Cl)Br)N |
Computed by PubChem (NCBI)