CAS 191608-21-6 appears in our catalog under these names: 7–Fluorochroman–4–amine hydrochloride, 7-Fluorochroman-4-amine hydrochloride, 98%, 98%, 7-Fluorochroman-4-amine hydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
7-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 191608-21-6) is a chemical compound with the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. IUPAC name: 7-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: NTOXKACXYHMVON-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO |
|---|---|
| Molecular weight | 203.64 g/mol |
| IUPAC name | 7-fluoro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | NTOXKACXYHMVON-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=CC(=C2)F.Cl |
Computed by PubChem (NCBI)