CAS 1266936-58-6 appears in our catalog under these names: 2-(Oxolan-2-yl)-1,3-thiazole-5-carboxylic acid, 98%, 2-(Oxolan-2-yl)-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid (CAS 1266936-58-6) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid. InChIKey: MEPUJIXKIDJYNN-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | MEPUJIXKIDJYNN-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)