CAS 1267348-12-8 is the registry number for 5-Amino-7-bromobenzo[d]oxazol-2(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-7-bromo-3H-1,3-benzoxazol-2-one (CAS 1267348-12-8) is a chemical compound with the molecular formula C7H5BrN2O2 and a molecular weight of 229.03 g/mol. IUPAC name: 5-amino-7-bromo-3H-1,3-benzoxazol-2-one. InChIKey: NJXKEICRIHQSEX-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O2 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 5-amino-7-bromo-3H-1,3-benzoxazol-2-one |
| InChIKey | NJXKEICRIHQSEX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)O2)Br)N |
Computed by PubChem (NCBI)