CAS 1380571-64-1 is the registry number for 6-Bromo-4,8-dihydro-2H-pyrido[3,2-d][1,3]oxazin-2-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4,8-dihydropyrido[3,2-d][1,3]oxazin-2-one (CAS 1380571-64-1) is a chemical compound with the molecular formula C7H5BrN2O2 and a molecular weight of 229.03 g/mol. IUPAC name: 6-bromo-4,8-dihydropyrido[3,2-d][1,3]oxazin-2-one. InChIKey: JASBHTDBEZJJTR-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O2 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 6-bromo-4,8-dihydropyrido[3,2-d][1,3]oxazin-2-one |
| InChIKey | JASBHTDBEZJJTR-UHFFFAOYSA-N |
| SMILES | C1C=C(N=C2C1=NC(=O)OC2)Br |
Computed by PubChem (NCBI)