CAS 335032-38-7 appears in our catalog under these names: 6-Bromo-1h-pyrido[2,3-d][1,3]oxazin-2(4h)-one, 95%, 6-Bromo-1,4-dihydro-2H-pyrido-(2,3-d)(1,3)oxazin-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
6-bromo-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one (CAS 335032-38-7) is a chemical compound with the molecular formula C7H5BrN2O2 and a molecular weight of 229.03 g/mol. IUPAC name: 6-bromo-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one. InChIKey: UQKSYBHWHOLZKA-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O2 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 6-bromo-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
| InChIKey | UQKSYBHWHOLZKA-UHFFFAOYSA-N |
| SMILES | C1C2=C(NC(=O)O1)N=CC(=C2)Br |
Computed by PubChem (NCBI)