CAS 938122-94-2 is the registry number for 3-(5-Bromofuran-2-yl)-1,2-oxazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(5-bromofuran-2-yl)-1,2-oxazol-5-amine (CAS 938122-94-2) is a chemical compound with the molecular formula C7H5BrN2O2 and a molecular weight of 229.03 g/mol. IUPAC name: 3-(5-bromofuran-2-yl)-1,2-oxazol-5-amine. InChIKey: MTDQAANDQCLXHZ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O2 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 3-(5-bromofuran-2-yl)-1,2-oxazol-5-amine |
| InChIKey | MTDQAANDQCLXHZ-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)C2=NOC(=C2)N |
Computed by PubChem (NCBI)