CAS 126759-36-2 is the registry number for Methyl 3-nitro-4-vinylbenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-ethenyl-3-nitrobenzoate (CAS 126759-36-2) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: methyl 4-ethenyl-3-nitrobenzoate. InChIKey: RQBYCISZMSTGAG-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | methyl 4-ethenyl-3-nitrobenzoate |
| InChIKey | RQBYCISZMSTGAG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C=C)[N+](=O)[O-] |
Computed by PubChem (NCBI)