Products 1268024-07-2
CAS 1268024-07-2 appears in our catalog under these names: Dimethyl 2-hydroxy-2,3-dihydrobenzofuran-4,6-dicarboxylate, 95%, Dimethyl 2-Hydroxy-2，3-Dihydrobenzofuran-4，6-Dicarboxylate, 95%, Dimethyl 2-Hydroxy-2，3-Dihydrobenzofuran-4，6-Dicarboxylate, 95%, 95%, CS-0045569, 95%. Offered by: BLDpharm, Fluorochem, Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Dimethyl 2-hydroxy-2,3-dihydro-1-benzofuran-4,6-dicarboxylate (CAS 1268024-07-2) is a chemical compound with the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. IUPAC name: dimethyl 2-hydroxy-2,3-dihydro-1-benzofuran-4,6-dicarboxylate. InChIKey: ZXPCVOXTVBVAIK-UHFFFAOYSA-N.
| Molecular formula | C12H12O6 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | dimethyl 2-hydroxy-2,3-dihydro-1-benzofuran-4,6-dicarboxylate |
| InChIKey | ZXPCVOXTVBVAIK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C2CC(OC2=C1)O)C(=O)OC |
Computed by PubChem (NCBI)