CAS 126807-08-7 appears in our catalog under these names: 3-Bromo-4-nitroindole, 97%, 3–Bromo–4–nitroindole, 3-Bromo-4-nitroindole, 97% , 3-Bromo-4-nitroindole, 95%, 95%, 3-BROMO-4-NITROINDOLE, 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 5g, 205mg, 1g, 250mg, 100mg, 25g.
3-bromo-4-nitro-1H-indole (CAS 126807-08-7) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 3-bromo-4-nitro-1H-indole. InChIKey: VYQRPDVMVMLVHA-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 3-bromo-4-nitro-1H-indole |
| InChIKey | VYQRPDVMVMLVHA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=CN2)Br |
Computed by PubChem (NCBI)