CAS 126813-11-4 is the registry number for Thiamphenicol Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
[(4R,5R)-2-(dichloromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol (CAS 126813-11-4) is a chemical compound with the molecular formula C12H13Cl2NO4S and a molecular weight of 338.2 g/mol. IUPAC name: [(4R,5R)-2-(dichloromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol. InChIKey: FDEUVCZXCFSQEE-NXEZZACHSA-N.
| Molecular formula | C12H13Cl2NO4S |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | [(4R,5R)-2-(dichloromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol |
| InChIKey | FDEUVCZXCFSQEE-NXEZZACHSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@@H]2[C@H](N=C(O2)C(Cl)Cl)CO |
Computed by PubChem (NCBI)