Products 593261-86-0

CAS 593261-86-0 is the registry number for 1-[(2,5-Dichlorophenyl)sulfonyl]piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(2,5-dichlorophenyl)sulfonylpiperidine-4-carboxylic acid (CAS 593261-86-0) is a chemical compound with the molecular formula C12H13Cl2NO4S and a molecular weight of 338.2 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: NHAWGNSCMJUWBC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13Cl2NO4S
Molecular weight338.2 g/mol
IUPAC name1-(2,5-dichlorophenyl)sulfonylpiperidine-4-carboxylic acid
InChIKeyNHAWGNSCMJUWBC-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)S(=O)(=O)C2=C(C=CC(=C2)Cl)Cl

Computed by PubChem (NCBI)