Products 53552-35-5

CAS 53552-35-5 appears in our catalog under these names: 2,4-Dichloro-5-(piperidin-1-ylsulfonyl)benzoic acid, 95%, 2,4-Dichloro-5-(piperidin-1-ylsulfonyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-piperidin-1-ylsulfonylbenzoic acid (CAS 53552-35-5) is a chemical compound with the molecular formula C12H13Cl2NO4S and a molecular weight of 338.2 g/mol. IUPAC name: 2,4-dichloro-5-piperidin-1-ylsulfonylbenzoic acid. InChIKey: WMSIRTDPQHCVPS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13Cl2NO4S
Molecular weight338.2 g/mol
IUPAC name2,4-dichloro-5-piperidin-1-ylsulfonylbenzoic acid
InChIKeyWMSIRTDPQHCVPS-UHFFFAOYSA-N
SMILESC1CCN(CC1)S(=O)(=O)C2=C(C=C(C(=C2)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)