CAS 730950-97-7 appears in our catalog under these names: 1-[(2,6-Dichlorophenyl)sulfonyl]piperidine-4-carboxylic acid, 95%, 1-(2,6-Dichlorobenzenesulfonyl)piperidine-4-carboxylic acid, 95%, 1-(2,6-Dichlorobenzenesulfonyl)piperidine-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carboxylic acid (CAS 730950-97-7) is a chemical compound with the molecular formula C12H13Cl2NO4S and a molecular weight of 338.2 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: POFUGOIQDWYLRO-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2NO4S |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | 1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | POFUGOIQDWYLRO-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)S(=O)(=O)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)