CAS 24164-06-5 appears in our catalog under these names: Methyl (S)–2–((tert–butoxycarbonyl)(methyl)amino)–3–methylbutanoate, NSC 135130, 97%, 97%, NSC 135130, (S)-METHYL 2-((TERT-BUTOXYCARBONYL)(METHYL)AMINO)-3-METHYLBUTANOATE, 97%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g, 50 mg, 100 mg, 250 mg.
Methyl (2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate (CAS 24164-06-5) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: methyl (2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate. InChIKey: JHELVJNRWQYMIA-VIFPVBQESA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | methyl (2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate |
| InChIKey | JHELVJNRWQYMIA-VIFPVBQESA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)