CAS 126889-06-3 appears in our catalog under these names: 4-Methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid, 4-Methyl-2-(trifluoromethyl)thiazole-5-carboxylic acid, 95%, 95%, 4-Methyl-2-(trifluoromethyl)thiazole-5-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 126889-06-3) is a chemical compound with the molecular formula C6H4F3NO2S and a molecular weight of 211.16 g/mol. IUPAC name: 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: DMKDYSIOZORCEB-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2S |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | DMKDYSIOZORCEB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)