CAS 1269151-06-5 appears in our catalog under these names: 3-Amino-6,7-dichloroindolin-2-one hydrochloride, 95%, 3-Amino-6,7-dichloro-2,3-dihydro-1H-indol-2-one hydrochloride, 3-amino-6,7-dichloroindolin-2-one hydrochloride, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 50mg, 0,5g, 100mg, 250mg.
3-amino-6,7-dichloro-1,3-dihydroindol-2-one;hydrochloride (CAS 1269151-06-5) is a chemical compound with the molecular formula C8H7Cl3N2O and a molecular weight of 253.5 g/mol. IUPAC name: 3-amino-6,7-dichloro-1,3-dihydroindol-2-one;hydrochloride. InChIKey: VSJZQHWDPBECBV-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3N2O |
|---|---|
| Molecular weight | 253.5 g/mol |
| IUPAC name | 3-amino-6,7-dichloro-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | VSJZQHWDPBECBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(C(=O)N2)N)Cl)Cl.Cl |
Computed by PubChem (NCBI)