CAS 726150-82-9 is the registry number for 2-Chloro-N-(3,5-dichloro-4-methylpyridin-2-yl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-(3,5-dichloro-4-methyl-2-pyridinyl)acetamide (CAS 726150-82-9) is a chemical compound with the molecular formula C8H7Cl3N2O and a molecular weight of 253.5 g/mol. IUPAC name: 2-chloro-N-(3,5-dichloro-4-methyl-2-pyridinyl)acetamide. InChIKey: HLKNVCUSLHZNDM-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3N2O |
|---|---|
| Molecular weight | 253.5 g/mol |
| IUPAC name | 2-chloro-N-(3,5-dichloro-4-methyl-2-pyridinyl)acetamide |
| InChIKey | HLKNVCUSLHZNDM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1Cl)NC(=O)CCl)Cl |
Computed by PubChem (NCBI)