CAS 1803570-88-8 is the registry number for (4,6-Dichloro-1H-1,3-benzodiazol-2-yl)methanol hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(4,6-dichloro-1H-benzimidazol-2-yl)methanol;hydrochloride (CAS 1803570-88-8) is a chemical compound with the molecular formula C8H7Cl3N2O and a molecular weight of 253.5 g/mol. IUPAC name: (4,6-dichloro-1H-benzimidazol-2-yl)methanol;hydrochloride. InChIKey: VVVDYFMCFGMFFQ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3N2O |
|---|---|
| Molecular weight | 253.5 g/mol |
| IUPAC name | (4,6-dichloro-1H-benzimidazol-2-yl)methanol;hydrochloride |
| InChIKey | VVVDYFMCFGMFFQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=N2)CO)Cl)Cl.Cl |
Computed by PubChem (NCBI)